About 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile
2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile (PubChem CID 112740359) has the molecular formula C14H16ClN3
and a molecular weight of 261.76 g/mol. Its IUPAC name is 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile |
| PubChem CID | 112740359 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile |
| SMILES | N#Cc1c(Cl)cccc1N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C14H16ClN3/c15-12-2-1-3-13(11(12)8-16)18-7-5-14(10-18)4-6-17-9-14/h1-3,17H,4-7,9-10H2 |
| InChIKey | IVFRFDJKMAVJFR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile?
The IUPAC name of 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile (CID 112740359) is 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile.
What is the SMILES notation for 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile?
The canonical SMILES for 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile is N#Cc1c(Cl)cccc1N1CCC2(CCNC2)C1.
What is the InChIKey of 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile?
The InChIKey is IVFRFDJKMAVJFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3/c15-12-2-1-3-13(11(12)8-16)18-7-5-14(10-18)4-6-17-9-14/h1-3,17H,4-7,9-10H2.
What are the key properties of 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile?
2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile has a molecular weight of 261.76 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(2,7-diazaspiro[4.4]nonan-2-yl)benzonitrile is sourced from PubChem (CID 112740359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).