C17H23N3S — CID 102850542
2-(2,8-diazaspiro[5.5]undecan-2-yl)-6-methylsulfanylbenzonitrile (PubChem CID 102850542) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is 2-(2,8-diazaspiro[5.5]undecan-2-yl)-6-methylsulfanylbenzonitrile.
| Compound Name | 2-(2,8-diazaspiro[5.5]undecan-2-yl)-6-methylsulfanylbenzonitrile |
|---|---|
| PubChem CID | 102850542 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-(2,8-diazaspiro[5.5]undecan-2-yl)-6-methylsulfanylbenzonitrile |
| SMILES | CSc1cccc(N2CCCC3(CCCNC3)C2)c1C#N |
| InChI | InChI=1S/C17H23N3S/c1-21-16-6-2-5-15(14(16)11-18)20-10-4-8-17(13-20)7-3-9-19-12-17/h2,5-6,19H,3-4,7-10,12-13H2,1H3 |
| InChIKey | ZZAUXFSHVBRAHJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |