C16H18N4O — CID 175905688
2-cyclopropyl-4-(furan-2-ylmethylimino)-1,3-dihydroquinazolin-2-amine (PubChem CID 175905688) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-cyclopropyl-4-(furan-2-ylmethylimino)-1,3-dihydroquinazolin-2-amine.
| Compound Name | 2-cyclopropyl-4-(furan-2-ylmethylimino)-1,3-dihydroquinazolin-2-amine |
|---|---|
| PubChem CID | 175905688 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-cyclopropyl-4-(furan-2-ylmethylimino)-1,3-dihydroquinazolin-2-amine |
| SMILES | NC1(C2CC2)N/C(=N/Cc2ccco2)c2ccccc2N1 |
| InChI | InChI=1S/C16H18N4O/c17-16(11-7-8-11)19-14-6-2-1-5-13(14)15(20-16)18-10-12-4-3-9-21-12/h1-6,9,11,19H,7-8,10,17H2,(H,18,20) |
| InChIKey | DMVBJYSUNOTYDF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|