C12H17NO — CID 21317040
N-(furan-2-ylmethyl)-2,5-dimethylcyclopentan-1-imine (PubChem CID 21317040) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,5-dimethylcyclopentan-1-imine.
| Compound Name | N-(furan-2-ylmethyl)-2,5-dimethylcyclopentan-1-imine |
|---|---|
| PubChem CID | 21317040 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,5-dimethylcyclopentan-1-imine |
| SMILES | CC1CCC(C)C1=NCc1ccco1 |
| InChI | InChI=1S/C12H17NO/c1-9-5-6-10(2)12(9)13-8-11-4-3-7-14-11/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | IIQCOBWCVXQSKT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|