C17H23N3O4S — CID 135562828
(2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-1-morpholin-4-ylpentan-1-one (PubChem CID 135562828) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-1-morpholin-4-ylpentan-1-one.
| Compound Name | (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-1-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 135562828 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-1-morpholin-4-ylpentan-1-one |
| SMILES | CC[C@H](C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H23N3O4S/c1-3-12(2)15(17(21)20-8-10-24-11-9-20)18-16-13-6-4-5-7-14(13)25(22,23)19-16/h4-7,12,15H,3,8-11H2,1-2H3,(H,18,19)/t12-,15-/m0/s1 |
| InChIKey | RCINMEREZXJKTA-WFASDCNBSA-N |
| XLogP | 1.00 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|