C15H18N4O5S2 — CID 19506326
1-[1-oxo-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-2-yl]pyrazole-3-carboxylic acid (PubChem CID 19506326) has the molecular formula C15H18N4O5S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-[1-oxo-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-2-yl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[1-oxo-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-2-yl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19506326 |
| Molecular Formula | C15H18N4O5S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 1-[1-oxo-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-2-yl]pyrazole-3-carboxylic acid |
| SMILES | CC(C(=O)N1CCN(S(=O)(=O)c2cccs2)CC1)n1ccc(C(=O)O)n1 |
| InChI | InChI=1S/C15H18N4O5S2/c1-11(19-5-4-12(16-19)15(21)22)14(20)17-6-8-18(9-7-17)26(23,24)13-3-2-10-25-13/h2-5,10-11H,6-9H2,1H3,(H,21,22) |
| InChIKey | CVHZORVSQZAQHN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |