C14H16N4O5S2 — CID 19502329
1-[2-oxo-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethyl]pyrazole-3-carboxylic acid (PubChem CID 19502329) has the molecular formula C14H16N4O5S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-[2-oxo-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19502329 |
| Molecular Formula | C14H16N4O5S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 1-[2-oxo-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(CC(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)n1 |
| InChI | InChI=1S/C14H16N4O5S2/c19-12(10-17-4-3-11(15-17)14(20)21)16-5-7-18(8-6-16)25(22,23)13-2-1-9-24-13/h1-4,9H,5-8,10H2,(H,20,21) |
| InChIKey | WHJCZLAZTQIOJP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |