C15H20N4O3S2 — CID 19536478
2-(3-methylpyrazol-1-yl)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one (PubChem CID 19536478) has the molecular formula C15H20N4O3S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-(3-methylpyrazol-1-yl)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-(3-methylpyrazol-1-yl)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 19536478 |
| Molecular Formula | C15H20N4O3S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-(3-methylpyrazol-1-yl)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-1-one |
| SMILES | Cc1ccn(C(C)C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)n1 |
| InChI | InChI=1S/C15H20N4O3S2/c1-12-5-6-19(16-12)13(2)15(20)17-7-9-18(10-8-17)24(21,22)14-4-3-11-23-14/h3-6,11,13H,7-10H2,1-2H3 |
| InChIKey | LIUBCSCXFLDPML-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |