C20H22N4O4S2 — CID 2551523
2-propan-2-yl-4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)phthalazin-1-one (PubChem CID 2551523) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-propan-2-yl-4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)phthalazin-1-one.
| Compound Name | 2-propan-2-yl-4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)phthalazin-1-one |
|---|---|
| PubChem CID | 2551523 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-propan-2-yl-4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)phthalazin-1-one |
| SMILES | CC(C)n1nc(C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H22N4O4S2/c1-14(2)24-19(25)16-7-4-3-6-15(16)18(21-24)20(26)22-9-11-23(12-10-22)30(27,28)17-8-5-13-29-17/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | WEPSEBCMKGSBPJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |