C14H18N4O5S2 — CID 155959430
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(1,1-dioxo-1,2,5-thiadiazepan-5-yl)propan-1-one (PubChem CID 155959430) has the molecular formula C14H18N4O5S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(1,1-dioxo-1,2,5-thiadiazepan-5-yl)propan-1-one.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(1,1-dioxo-1,2,5-thiadiazepan-5-yl)propan-1-one |
|---|---|
| PubChem CID | 155959430 |
| Molecular Formula | C14H18N4O5S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-1-(1,1-dioxo-1,2,5-thiadiazepan-5-yl)propan-1-one |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCNS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H18N4O5S2/c1-10(14(19)18-7-6-15-24(20,21)9-8-18)16-13-11-4-2-3-5-12(11)25(22,23)17-13/h2-5,10,15H,6-9H2,1H3,(H,16,17) |
| InChIKey | MZDNVKFGLTXWCF-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|