C19H25N3OS — CID 119834099
3-amino-2-methyl-3-phenyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one (PubChem CID 119834099) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 3-amino-2-methyl-3-phenyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-amino-2-methyl-3-phenyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 119834099 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 3-amino-2-methyl-3-phenyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(C(=O)N1CCN(Cc2cccs2)CC1)C(N)c1ccccc1 |
| InChI | InChI=1S/C19H25N3OS/c1-15(18(20)16-6-3-2-4-7-16)19(23)22-11-9-21(10-12-22)14-17-8-5-13-24-17/h2-8,13,15,18H,9-12,14,20H2,1H3 |
| InChIKey | HSFUVOGJBMFKJF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |