C18H25Cl2N3OS — CID 119834080
2-amino-3-phenyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one;dihydrochloride (PubChem CID 119834080) has the molecular formula C18H25Cl2N3OS and a molecular weight of 402.39 g/mol. Its IUPAC name is 2-amino-3-phenyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one;dihydrochloride.
| Compound Name | 2-amino-3-phenyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119834080 |
| Molecular Formula | C18H25Cl2N3OS |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-amino-3-phenyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.NC(Cc1ccccc1)C(=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C18H23N3OS.2ClH/c19-17(13-15-5-2-1-3-6-15)18(22)21-10-8-20(9-11-21)14-16-7-4-12-23-16;;/h1-7,12,17H,8-11,13-14,19H2;2*1H |
| InChIKey | RXAVUBOBXBGODM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |