C19H19N3O3S — CID 135659947
(2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide (PubChem CID 135659947) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide.
| Compound Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 135659947 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2S)-N-(2,3-dihydro-1H-inden-5-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H19N3O3S/c1-12(19(23)21-15-10-9-13-5-4-6-14(13)11-15)20-18-16-7-2-3-8-17(16)26(24,25)22-18/h2-3,7-12H,4-6H2,1H3,(H,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | MBNLABVPFDRKIA-LBPRGKRZSA-N |
| XLogP | 2.24 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|