C19H28N4O3S — CID 137122528
N-(2-amino-1-cyclohexylethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanamide (PubChem CID 137122528) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanamide |
|---|---|
| PubChem CID | 137122528 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanamide |
| SMILES | NCC(NC(=O)CCC/N=C1\NS(=O)(=O)c2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C19H28N4O3S/c20-13-16(14-7-2-1-3-8-14)22-18(24)11-6-12-21-19-15-9-4-5-10-17(15)27(25,26)23-19/h4-5,9-10,14,16H,1-3,6-8,11-13,20H2,(H,21,23)(H,22,24) |
| InChIKey | ROWIIUACFBYGJG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|