C25H25N3O5S — CID 135798342
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]butanamide (PubChem CID 135798342) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]butanamide.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]butanamide |
|---|---|
| PubChem CID | 135798342 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]butanamide |
| SMILES | COc1ccc(-c2cc(NC(=O)CCC/N=C3\NS(=O)(=O)c4ccccc43)ccc2OC)cc1 |
| InChI | InChI=1S/C25H25N3O5S/c1-32-19-12-9-17(10-13-19)21-16-18(11-14-22(21)33-2)27-24(29)8-5-15-26-25-20-6-3-4-7-23(20)34(30,31)28-25/h3-4,6-7,9-14,16H,5,8,15H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | QUVBHNRKBYJCNM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|