C18H28N4O — CID 95629165
(2S)-2-ethyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]octanamide (PubChem CID 95629165) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (2S)-2-ethyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]octanamide.
| Compound Name | (2S)-2-ethyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]octanamide |
|---|---|
| PubChem CID | 95629165 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (2S)-2-ethyl-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]octanamide |
| SMILES | CCCCCC[C@H](CC)C(=O)NCCc1nnc2ccccn12 |
| InChI | InChI=1S/C18H28N4O/c1-3-5-6-7-10-15(4-2)18(23)19-13-12-17-21-20-16-11-8-9-14-22(16)17/h8-9,11,14-15H,3-7,10,12-13H2,1-2H3,(H,19,23)/t15-/m0/s1 |
| InChIKey | HDYBQCJYPHWEDH-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|