C25H24FN3O5S — CID 135959710
[2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135959710) has the molecular formula C25H24FN3O5S and a molecular weight of 497.55 g/mol. Its IUPAC name is [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135959710 |
| Molecular Formula | C25H24FN3O5S |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [2-[1-(3-fluoro-4-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)COC(=O)CC/N=C3\NS(=O)(=O)c4ccccc43)c2C)cc1F |
| InChI | InChI=1S/C25H24FN3O5S/c1-15-8-9-18(13-21(15)26)29-16(2)12-20(17(29)3)22(30)14-34-24(31)10-11-27-25-19-6-4-5-7-23(19)35(32,33)28-25/h4-9,12-13H,10-11,14H2,1-3H3,(H,27,28) |
| InChIKey | CSQVSJRGZPVEMK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|