C21H20N2O3S — CID 137266143
1,1-dioxo-N-[(2-propan-2-yloxynaphthalen-1-yl)methyl]-1,2-benzothiazol-3-imine (PubChem CID 137266143) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1,1-dioxo-N-[(2-propan-2-yloxynaphthalen-1-yl)methyl]-1,2-benzothiazol-3-imine.
| Compound Name | 1,1-dioxo-N-[(2-propan-2-yloxynaphthalen-1-yl)methyl]-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137266143 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1,1-dioxo-N-[(2-propan-2-yloxynaphthalen-1-yl)methyl]-1,2-benzothiazol-3-imine |
| SMILES | CC(C)Oc1ccc2ccccc2c1C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C21H20N2O3S/c1-14(2)26-19-12-11-15-7-3-4-8-16(15)18(19)13-22-21-17-9-5-6-10-20(17)27(24,25)23-21/h3-12,14H,13H2,1-2H3,(H,22,23) |
| InChIKey | ANXVFZHTXGQJIR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|