C24H14N2O4Si — CID 102189646
3,3'-dinitro-5,5'-spirobi[benzo[b][1]benzosilole] (PubChem CID 102189646) has the molecular formula C24H14N2O4Si and a molecular weight of 422.47 g/mol. Its IUPAC name is 3,3'-dinitro-5,5'-spirobi[benzo[b][1]benzosilole].
| Compound Name | 3,3'-dinitro-5,5'-spirobi[benzo[b][1]benzosilole] |
|---|---|
| PubChem CID | 102189646 |
| Molecular Formula | C24H14N2O4Si |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 3,3'-dinitro-5,5'-spirobi[benzo[b][1]benzosilole] |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[Si]1(c3ccccc3-2)c2ccccc2-c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C24H14N2O4Si/c27-25(28)15-9-11-19-17-5-1-3-7-21(17)31(23(19)13-15)22-8-4-2-6-18(22)20-12-10-16(26(29)30)14-24(20)31/h1-14H |
| InChIKey | CBNSIPIKNZEMOB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|