C13H13N3O3S — CID 136794518
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 136794518) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 136794518 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | CCc1cnc(C/N=C2\NS(=O)(=O)c3ccccc32)o1 |
| InChI | InChI=1S/C13H13N3O3S/c1-2-9-7-14-12(19-9)8-15-13-10-5-3-4-6-11(10)20(17,18)16-13/h3-7H,2,8H2,1H3,(H,15,16) |
| InChIKey | YFAWLTHQWNDPBL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|