C15H16N2O4S — CID 137263071
1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-(5-methylfuran-2-yl)propan-2-ol (PubChem CID 137263071) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-(5-methylfuran-2-yl)propan-2-ol.
| Compound Name | 1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-(5-methylfuran-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 137263071 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-(5-methylfuran-2-yl)propan-2-ol |
| SMILES | Cc1ccc(C(C)(O)C/N=C2\NS(=O)(=O)c3ccccc32)o1 |
| InChI | InChI=1S/C15H16N2O4S/c1-10-7-8-13(21-10)15(2,18)9-16-14-11-5-3-4-6-12(11)22(19,20)17-14/h3-8,18H,9H2,1-2H3,(H,16,17) |
| InChIKey | HQBIJDBZNCMBJS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|