C17H16ClFN2O2S — CID 137266318
N-[2-(3-chloro-2-fluorophenyl)-2-methylpropyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 137266318) has the molecular formula C17H16ClFN2O2S and a molecular weight of 366.85 g/mol. Its IUPAC name is N-[2-(3-chloro-2-fluorophenyl)-2-methylpropyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[2-(3-chloro-2-fluorophenyl)-2-methylpropyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137266318 |
| Molecular Formula | C17H16ClFN2O2S |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[2-(3-chloro-2-fluorophenyl)-2-methylpropyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | CC(C)(C/N=C1\NS(=O)(=O)c2ccccc21)c1cccc(Cl)c1F |
| InChI | InChI=1S/C17H16ClFN2O2S/c1-17(2,12-7-5-8-13(18)15(12)19)10-20-16-11-6-3-4-9-14(11)24(22,23)21-16/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | DCAOQMPBDAOVGF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|