C19H19Cl2N3O3S — CID 137172438
2,4-dichloro-N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2,2-dimethylpropyl]benzamide (PubChem CID 137172438) has the molecular formula C19H19Cl2N3O3S and a molecular weight of 440.35 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2,2-dimethylpropyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 137172438 |
| Molecular Formula | C19H19Cl2N3O3S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2,4-dichloro-N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2,2-dimethylpropyl]benzamide |
| SMILES | CC(C)(C/N=C1\NS(=O)(=O)c2ccccc21)CNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O3S/c1-19(2,11-23-18(25)13-8-7-12(20)9-15(13)21)10-22-17-14-5-3-4-6-16(14)28(26,27)24-17/h3-9H,10-11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | IGLODYDHMBJAKK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|