C22H23N3O7S — CID 135925566
butyl 4-[[2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]oxyacetyl]amino]benzoate (PubChem CID 135925566) has the molecular formula C22H23N3O7S and a molecular weight of 473.51 g/mol. Its IUPAC name is butyl 4-[[2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]oxyacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 135925566 |
| Molecular Formula | C22H23N3O7S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | butyl 4-[[2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)C/N=C2\NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H23N3O7S/c1-2-3-12-31-22(28)15-8-10-16(11-9-15)24-19(26)14-32-20(27)13-23-21-17-6-4-5-7-18(17)33(29,30)25-21/h4-11H,2-3,12-14H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | DRAHCVKBPQIAAQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|