C18H19N3O3S — CID 136644396
N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl]-4-methylbenzamide (PubChem CID 136644396) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl]-4-methylbenzamide.
| Compound Name | N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 136644396 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCC/N=C2\NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H19N3O3S/c1-13-7-9-14(10-8-13)18(22)20-12-4-11-19-17-15-5-2-3-6-16(15)25(23,24)21-17/h2-3,5-10H,4,11-12H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | VKFARTNLBMXLGY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|