C20H18N6O4S — CID 135535624
N'-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 135535624) has the molecular formula C20H18N6O4S and a molecular weight of 438.47 g/mol. Its IUPAC name is N'-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 135535624 |
| Molecular Formula | C20H18N6O4S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N'-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C20H18N6O4S/c27-18(10-11-21-19-14-8-4-5-9-17(14)31(29,30)26-19)24-25-20(28)16-12-15(22-23-16)13-6-2-1-3-7-13/h1-9,12H,10-11H2,(H,21,26)(H,22,23)(H,24,27)(H,25,28) |
| InChIKey | CUGIHPOEEUZXBX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|