C13H12ClN3O3S — CID 60698896
1-(4-chloro-1H-pyrrole-2-carbonyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 60698896) has the molecular formula C13H12ClN3O3S and a molecular weight of 325.78 g/mol. Its IUPAC name is 1-(4-chloro-1H-pyrrole-2-carbonyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(4-chloro-1H-pyrrole-2-carbonyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 60698896 |
| Molecular Formula | C13H12ClN3O3S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 1-(4-chloro-1H-pyrrole-2-carbonyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C13H12ClN3O3S/c14-9-6-11(16-7-9)13(18)17-4-3-8-5-10(21(15,19)20)1-2-12(8)17/h1-2,5-7,16H,3-4H2,(H2,15,19,20) |
| InChIKey | XTFZKKKTUCNRFE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |