C21H25NO4S — CID 26528535
[2-[(2R)-butan-2-yl]phenyl] 1-acetyl-3,4-dihydro-2H-quinoline-6-sulfonate (PubChem CID 26528535) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is [2-[(2R)-butan-2-yl]phenyl] 1-acetyl-3,4-dihydro-2H-quinoline-6-sulfonate.
| Compound Name | [2-[(2R)-butan-2-yl]phenyl] 1-acetyl-3,4-dihydro-2H-quinoline-6-sulfonate |
|---|---|
| PubChem CID | 26528535 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [2-[(2R)-butan-2-yl]phenyl] 1-acetyl-3,4-dihydro-2H-quinoline-6-sulfonate |
| SMILES | CC[C@@H](C)c1ccccc1OS(=O)(=O)c1ccc2c(c1)CCCN2C(C)=O |
| InChI | InChI=1S/C21H25NO4S/c1-4-15(2)19-9-5-6-10-21(19)26-27(24,25)18-11-12-20-17(14-18)8-7-13-22(20)16(3)23/h5-6,9-12,14-15H,4,7-8,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | KRXKZWPKTIISOA-OAHLLOKOSA-N |
| XLogP | 4.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|