C16H14Cl2N2O — CID 134093336
6-chloro-N-(4-chlorophenyl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 134093336) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 6-chloro-N-(4-chlorophenyl)-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | 6-chloro-N-(4-chlorophenyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 134093336 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 6-chloro-N-(4-chlorophenyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1CCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H14Cl2N2O/c17-12-3-6-14(7-4-12)19-16(21)20-9-1-2-11-10-13(18)5-8-15(11)20/h3-8,10H,1-2,9H2,(H,19,21) |
| InChIKey | IAEHJAFPMUPKTO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |