C16H14ClFN2O — CID 162489929
N-(3-chloro-4-fluorophenyl)-5-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 162489929) has the molecular formula C16H14ClFN2O and a molecular weight of 304.75 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 162489929 |
| Molecular Formula | C16H14ClFN2O |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | Cc1ccc2c(c1)CCN2C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClFN2O/c1-10-2-5-15-11(8-10)6-7-20(15)16(21)19-12-3-4-14(18)13(17)9-12/h2-5,8-9H,6-7H2,1H3,(H,19,21) |
| InChIKey | SMNUAHFSPVSMHQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |