C15H19ClN2O — CID 110747460
5-chloro-N-cyclohexyl-2,3-dihydroindole-1-carboxamide (PubChem CID 110747460) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 5-chloro-N-cyclohexyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-chloro-N-cyclohexyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 110747460 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-chloro-N-cyclohexyl-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H19ClN2O/c16-12-6-7-14-11(10-12)8-9-18(14)15(19)17-13-4-2-1-3-5-13/h6-7,10,13H,1-5,8-9H2,(H,17,19) |
| InChIKey | ZTMRGWZYVDVEAA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |