C12H14N2O2 — CID 153363202
N-cyclopropyl-5-hydroxy-2,3-dihydroindole-1-carboxamide (PubChem CID 153363202) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-cyclopropyl-5-hydroxy-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-cyclopropyl-5-hydroxy-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 153363202 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-cyclopropyl-5-hydroxy-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(NC1CC1)N1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C12H14N2O2/c15-10-3-4-11-8(7-10)5-6-14(11)12(16)13-9-1-2-9/h3-4,7,9,15H,1-2,5-6H2,(H,13,16) |
| InChIKey | JWAWNNNSSBEXCI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |