C19H21ClN2O2 — CID 175260029
4-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-4-hydroxy-N-phenylbutanamide (PubChem CID 175260029) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 4-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-4-hydroxy-N-phenylbutanamide.
| Compound Name | 4-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-4-hydroxy-N-phenylbutanamide |
|---|---|
| PubChem CID | 175260029 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-4-hydroxy-N-phenylbutanamide |
| SMILES | O=C(CCC(O)N1CCCc2cc(Cl)ccc21)Nc1ccccc1 |
| InChI | InChI=1S/C19H21ClN2O2/c20-15-8-9-17-14(13-15)5-4-12-22(17)19(24)11-10-18(23)21-16-6-2-1-3-7-16/h1-3,6-9,13,19,24H,4-5,10-12H2,(H,21,23) |
| InChIKey | MOYQELFUACPVCR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |