C17H17FN2O — CID 10214790
8-fluoro-N-phenyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide (PubChem CID 10214790) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is 8-fluoro-N-phenyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide.
| Compound Name | 8-fluoro-N-phenyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
|---|---|
| PubChem CID | 10214790 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 8-fluoro-N-phenyl-2,3,4,5-tetrahydro-1-benzazepine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCCCc2ccc(F)cc21 |
| InChI | InChI=1S/C17H17FN2O/c18-14-10-9-13-6-4-5-11-20(16(13)12-14)17(21)19-15-7-2-1-3-8-15/h1-3,7-10,12H,4-6,11H2,(H,19,21) |
| InChIKey | YRIVCYUYRQRQKZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |