About 5-chloro-2,3-dihydroindole-1-carbothioamide
5-chloro-2,3-dihydroindole-1-carbothioamide (PubChem CID 45118592) has the molecular formula C9H9ClN2S
and a molecular weight of 212.71 g/mol. Its IUPAC name is 5-chloro-2,3-dihydroindole-1-carbothioamide.
Molecular Properties
| Compound Name | 5-chloro-2,3-dihydroindole-1-carbothioamide |
| PubChem CID | 45118592 |
| Molecular Formula | C9H9ClN2S |
| Molecular Weight | 212.71 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 5-chloro-2,3-dihydroindole-1-carbothioamide |
| SMILES | NC(=S)N1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H9ClN2S/c10-7-1-2-8-6(5-7)3-4-12(8)9(11)13/h1-2,5H,3-4H2,(H2,11,13) |
| InChIKey | ZLXNHTMGQNPGEX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.71 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,3-dihydroindole-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-dihydroindole-1-carbothioamide?
The IUPAC name of 5-chloro-2,3-dihydroindole-1-carbothioamide (CID 45118592) is 5-chloro-2,3-dihydroindole-1-carbothioamide.
What is the SMILES notation for 5-chloro-2,3-dihydroindole-1-carbothioamide?
The canonical SMILES for 5-chloro-2,3-dihydroindole-1-carbothioamide is NC(=S)N1CCc2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-2,3-dihydroindole-1-carbothioamide?
The InChIKey is ZLXNHTMGQNPGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2S/c10-7-1-2-8-6(5-7)3-4-12(8)9(11)13/h1-2,5H,3-4H2,(H2,11,13).
What are the key properties of 5-chloro-2,3-dihydroindole-1-carbothioamide?
5-chloro-2,3-dihydroindole-1-carbothioamide has a molecular weight of 212.71 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dihydroindole-1-carbothioamide is sourced from PubChem (CID 45118592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).