C9H9ClN2S — CID 45118592
5-chloro-2,3-dihydroindole-1-carbothioamide (PubChem CID 45118592) has the molecular formula C9H9ClN2S and a molecular weight of 212.71 g/mol. Its IUPAC name is 5-chloro-2,3-dihydroindole-1-carbothioamide.
| Compound Name | 5-chloro-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 45118592 |
| Molecular Formula | C9H9ClN2S |
| Molecular Weight | 212.71 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 5-chloro-2,3-dihydroindole-1-carbothioamide |
| SMILES | NC(=S)N1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H9ClN2S/c10-7-1-2-8-6(5-7)3-4-12(8)9(11)13/h1-2,5H,3-4H2,(H2,11,13) |
| InChIKey | ZLXNHTMGQNPGEX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.71 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|