C13H13ClN2O2 — CID 110742298
5-(5-chloro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one (PubChem CID 110742298) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 5-(5-chloro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one.
| Compound Name | 5-(5-chloro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 110742298 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-(5-chloro-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
| SMILES | O=C1CCC(C(=O)N2CCc3cc(Cl)ccc32)N1 |
| InChI | InChI=1S/C13H13ClN2O2/c14-9-1-3-11-8(7-9)5-6-16(11)13(18)10-2-4-12(17)15-10/h1,3,7,10H,2,4-6H2,(H,15,17) |
| InChIKey | AIDHQGQDUSDUTB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |