About 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one
5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one (PubChem CID 110742280) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
| PubChem CID | 110742280 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one |
| SMILES | COc1ccc2c(c1)CCN2C(=O)C1CCC(=O)N1 |
| InChI | InChI=1S/C14H16N2O3/c1-19-10-2-4-12-9(8-10)6-7-16(12)14(18)11-3-5-13(17)15-11/h2,4,8,11H,3,5-7H2,1H3,(H,15,17) |
| InChIKey | BKRDHGSKQYEONG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one?
The IUPAC name of 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one (CID 110742280) is 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one.
What is the SMILES notation for 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one?
The canonical SMILES for 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one is COc1ccc2c(c1)CCN2C(=O)C1CCC(=O)N1.
What is the InChIKey of 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one?
The InChIKey is BKRDHGSKQYEONG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-19-10-2-4-12-9(8-10)6-7-16(12)14(18)11-3-5-13(17)15-11/h2,4,8,11H,3,5-7H2,1H3,(H,15,17).
What are the key properties of 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one?
5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one has a molecular weight of 260.29 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methoxy-2,3-dihydroindole-1-carbonyl)pyrrolidin-2-one is sourced from PubChem (CID 110742280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).