C10H12N2O3 — CID 172651756
2,4-bis[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol (PubChem CID 172651756) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,4-bis[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol.
| Compound Name | 2,4-bis[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 172651756 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2,4-bis[(E)-N-hydroxy-C-methylcarbonimidoyl]phenol |
| SMILES | C/C(=N\O)c1ccc(O)c(/C(C)=N/O)c1 |
| InChI | InChI=1S/C10H12N2O3/c1-6(11-14)8-3-4-10(13)9(5-8)7(2)12-15/h3-5,13-15H,1-2H3/b11-6+,12-7+ |
| InChIKey | SMKKREVMSGDZPL-GNXRPPCSSA-N |
| XLogP | 1.79 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|