About 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol
4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol (PubChem CID 137262701) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol |
| PubChem CID | 137262701 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol |
| SMILES | C/C(=N/O)c1cc(C)c(O)cc1C |
| InChI | InChI=1S/C10H13NO2/c1-6-5-10(12)7(2)4-9(6)8(3)11-13/h4-5,12-13H,1-3H3/b11-8- |
| InChIKey | CJVBWJYBSQAPLW-FLIBITNWSA-N |
| XLogP | 2.21 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol?
The IUPAC name of 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol (CID 137262701) is 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol.
What is the SMILES notation for 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol?
The canonical SMILES for 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol is C/C(=N/O)c1cc(C)c(O)cc1C.
What is the InChIKey of 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol?
The InChIKey is CJVBWJYBSQAPLW-FLIBITNWSA-N. The full InChI is InChI=1S/C10H13NO2/c1-6-5-10(12)7(2)4-9(6)8(3)11-13/h4-5,12-13H,1-3H3/b11-8-.
What are the key properties of 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol?
4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol has a molecular weight of 179.22 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-2,5-dimethylphenol is sourced from PubChem (CID 137262701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).