C8H11N5 — CID 15857248
2-[(E)-1-pyridin-4-ylethylideneamino]guanidine (PubChem CID 15857248) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-[(E)-1-pyridin-4-ylethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-pyridin-4-ylethylideneamino]guanidine |
|---|---|
| PubChem CID | 15857248 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 2-[(E)-1-pyridin-4-ylethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1ccncc1 |
| InChI | InChI=1S/C8H11N5/c1-6(12-13-8(9)10)7-2-4-11-5-3-7/h2-5H,1H3,(H4,9,10,13)/b12-6+ |
| InChIKey | GFSHWYNRHCLFMR-WUXMJOGZSA-N |
| XLogP | 0.08 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|