About (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone
(2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone (PubChem CID 50932502) has the molecular formula C21H17N3O
and a molecular weight of 327.39 g/mol. Its IUPAC name is (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone.
Molecular Properties
| Compound Name | (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone |
| PubChem CID | 50932502 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone |
| SMILES | C/C(=N\N=C(/C(=O)c1ccccc1)c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C21H17N3O/c1-16(17-12-14-22-15-13-17)23-24-20(18-8-4-2-5-9-18)21(25)19-10-6-3-7-11-19/h2-15H,1H3/b23-16+,24-20- |
| InChIKey | NYUFOZPMJGUISG-QWMKXMQISA-N |
| XLogP | 4.18 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone?
The IUPAC name of (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone (CID 50932502) is (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone.
What is the SMILES notation for (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone?
The canonical SMILES for (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone is C/C(=N\N=C(/C(=O)c1ccccc1)c1ccccc1)c1ccncc1.
What is the InChIKey of (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone?
The InChIKey is NYUFOZPMJGUISG-QWMKXMQISA-N. The full InChI is InChI=1S/C21H17N3O/c1-16(17-12-14-22-15-13-17)23-24-20(18-8-4-2-5-9-18)21(25)19-10-6-3-7-11-19/h2-15H,1H3/b23-16+,24-20-.
What are the key properties of (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone?
(2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone has a molecular weight of 327.39 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1,2-diphenyl-2-[(E)-1-pyridin-4-ylethylidenehydrazinylidene]ethanone is sourced from PubChem (CID 50932502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).