C21H17N3O — CID 6524389
(2Z)-1,2-diphenyl-2-[(Z)-1-pyridin-3-ylethylidenehydrazinylidene]ethanone (PubChem CID 6524389) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is (2Z)-1,2-diphenyl-2-[(Z)-1-pyridin-3-ylethylidenehydrazinylidene]ethanone.
| Compound Name | (2Z)-1,2-diphenyl-2-[(Z)-1-pyridin-3-ylethylidenehydrazinylidene]ethanone |
|---|---|
| PubChem CID | 6524389 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2Z)-1,2-diphenyl-2-[(Z)-1-pyridin-3-ylethylidenehydrazinylidene]ethanone |
| SMILES | C/C(=N/N=C(\C(=O)c1ccccc1)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C21H17N3O/c1-16(19-13-8-14-22-15-19)23-24-20(17-9-4-2-5-10-17)21(25)18-11-6-3-7-12-18/h2-15H,1H3/b23-16-,24-20- |
| InChIKey | GCSZBOOAQPOVKW-OBWIWDAPSA-N |
| XLogP | 4.18 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|