About N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide
N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide (PubChem CID 135813165) has the molecular formula C12H15N5O2
and a molecular weight of 261.29 g/mol. Its IUPAC name is N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide.
Molecular Properties
| Compound Name | N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide |
| PubChem CID | 135813165 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide |
| SMILES | CC(=O)NC(=N/N=C(\C)c1cccnc1)NC(C)=O |
| InChI | InChI=1S/C12H15N5O2/c1-8(11-5-4-6-13-7-11)16-17-12(14-9(2)18)15-10(3)19/h4-7H,1-3H3,(H2,14,15,17,18,19)/b16-8+ |
| InChIKey | DVMPRNHXOHVSKA-LZYBPNLTSA-N |
| XLogP | 0.43 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide?
The IUPAC name of N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide (CID 135813165) is N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide.
What is the SMILES notation for N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide?
The canonical SMILES for N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide is CC(=O)NC(=N/N=C(\C)c1cccnc1)NC(C)=O.
What is the InChIKey of N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide?
The InChIKey is DVMPRNHXOHVSKA-LZYBPNLTSA-N. The full InChI is InChI=1S/C12H15N5O2/c1-8(11-5-4-6-13-7-11)16-17-12(14-9(2)18)15-10(3)19/h4-7H,1-3H3,(H2,14,15,17,18,19)/b16-8+.
What are the key properties of N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide?
N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide has a molecular weight of 261.29 g/mol, XLogP of 0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[N-acetyl-N'-[(E)-1-pyridin-3-ylethylideneamino]carbamimidoyl]acetamide is sourced from PubChem (CID 135813165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).