C12H14N4O2 — CID 9352199
N-cyclopropyl-N'-[(Z)-1-pyridin-3-ylethylideneamino]oxamide (PubChem CID 9352199) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-1-pyridin-3-ylethylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-1-pyridin-3-ylethylideneamino]oxamide |
|---|---|
| PubChem CID | 9352199 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-1-pyridin-3-ylethylideneamino]oxamide |
| SMILES | C/C(=N/NC(=O)C(=O)NC1CC1)c1cccnc1 |
| InChI | InChI=1S/C12H14N4O2/c1-8(9-3-2-6-13-7-9)15-16-12(18)11(17)14-10-4-5-10/h2-3,6-7,10H,4-5H2,1H3,(H,14,17)(H,16,18)/b15-8- |
| InChIKey | OGQRITYRKBTVDE-NVNXTCNLSA-N |
| XLogP | 0.20 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|