C8H10N4O — CID 5355222
[(Z)-1-pyridin-3-ylethylideneamino]urea (PubChem CID 5355222) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is [(Z)-1-pyridin-3-ylethylideneamino]urea.
| Compound Name | [(Z)-1-pyridin-3-ylethylideneamino]urea |
|---|---|
| PubChem CID | 5355222 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | [(Z)-1-pyridin-3-ylethylideneamino]urea |
| SMILES | C/C(=N/NC(N)=O)c1cccnc1 |
| InChI | InChI=1S/C8H10N4O/c1-6(11-12-8(9)13)7-3-2-4-10-5-7/h2-5H,1H3,(H3,9,12,13)/b11-6- |
| InChIKey | HODYXTJELSPOJM-WDZFZDKYSA-N |
| XLogP | 0.47 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|