C26H26N2O — CID 3524909
2-[1-(4-tert-butylphenyl)ethylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 3524909) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-[1-(4-tert-butylphenyl)ethylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | 2-[1-(4-tert-butylphenyl)ethylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 3524909 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[1-(4-tert-butylphenyl)ethylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | CC(=NN=C(C(=O)c1ccccc1)c1ccccc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H26N2O/c1-19(20-15-17-23(18-16-20)26(2,3)4)27-28-24(21-11-7-5-8-12-21)25(29)22-13-9-6-10-14-22/h5-18H,1-4H3 |
| InChIKey | IWJRGYZCWJEGNV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|