C22H16ClN3O3 — CID 18207176
(2E)-2-[(E)-1-(4-chloro-3-nitrophenyl)ethylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 18207176) has the molecular formula C22H16ClN3O3 and a molecular weight of 405.84 g/mol. Its IUPAC name is (2E)-2-[(E)-1-(4-chloro-3-nitrophenyl)ethylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2E)-2-[(E)-1-(4-chloro-3-nitrophenyl)ethylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 18207176 |
| Molecular Formula | C22H16ClN3O3 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (2E)-2-[(E)-1-(4-chloro-3-nitrophenyl)ethylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | C/C(=N\N=C(\C(=O)c1ccccc1)c1ccccc1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16ClN3O3/c1-15(18-12-13-19(23)20(14-18)26(28)29)24-25-21(16-8-4-2-5-9-16)22(27)17-10-6-3-7-11-17/h2-14H,1H3/b24-15+,25-21+ |
| InChIKey | UZFQSDSDLNDDQS-GFUUNDCYSA-N |
| XLogP | 5.34 |
| TPSA | 84.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|