C21H14ClN3O3 — CID 6906648
(2Z)-2-[(Z)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 6906648) has the molecular formula C21H14ClN3O3 and a molecular weight of 391.81 g/mol. Its IUPAC name is (2Z)-2-[(Z)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2Z)-2-[(Z)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 6906648 |
| Molecular Formula | C21H14ClN3O3 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | (2Z)-2-[(Z)-(4-chloro-3-nitrophenyl)methylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | O=C(/C(=N\N=C/c1ccc(Cl)c([N+](=O)[O-])c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H14ClN3O3/c22-18-12-11-15(13-19(18)25(27)28)14-23-24-20(16-7-3-1-4-8-16)21(26)17-9-5-2-6-10-17/h1-14H/b23-14-,24-20- |
| InChIKey | IZFVSONJDLDNKQ-RAIJVOLQSA-N |
| XLogP | 4.95 |
| TPSA | 84.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|