C24H19N2O4- — CID 9074352
2-[3-[(Z)-C-methyl-N-[(Z)-(2-oxo-1,2-diphenylethylidene)amino]carbonimidoyl]phenoxy]acetate (PubChem CID 9074352) has the molecular formula C24H19N2O4- and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-[3-[(Z)-C-methyl-N-[(Z)-(2-oxo-1,2-diphenylethylidene)amino]carbonimidoyl]phenoxy]acetate.
| Compound Name | 2-[3-[(Z)-C-methyl-N-[(Z)-(2-oxo-1,2-diphenylethylidene)amino]carbonimidoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9074352 |
| Molecular Formula | C24H19N2O4- |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[3-[(Z)-C-methyl-N-[(Z)-(2-oxo-1,2-diphenylethylidene)amino]carbonimidoyl]phenoxy]acetate |
| SMILES | C/C(=N/N=C(\C(=O)c1ccccc1)c1ccccc1)c1cccc(OCC(=O)[O-])c1 |
| InChI | InChI=1S/C24H20N2O4/c1-17(20-13-8-14-21(15-20)30-16-22(27)28)25-26-23(18-9-4-2-5-10-18)24(29)19-11-6-3-7-12-19/h2-15H,16H2,1H3,(H,27,28)/p-1/b25-17-,26-23- |
| InChIKey | LJCMYISPGYYGTA-TXRKAJQRSA-M |
| XLogP | 2.91 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|