C19H15ClN3O3- — CID 9076810
2-[3-[(Z)-N-[(7-chloroquinolin-4-yl)amino]-C-methylcarbonimidoyl]phenoxy]acetate (PubChem CID 9076810) has the molecular formula C19H15ClN3O3- and a molecular weight of 368.80 g/mol. Its IUPAC name is 2-[3-[(Z)-N-[(7-chloroquinolin-4-yl)amino]-C-methylcarbonimidoyl]phenoxy]acetate.
| Compound Name | 2-[3-[(Z)-N-[(7-chloroquinolin-4-yl)amino]-C-methylcarbonimidoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9076810 |
| Molecular Formula | C19H15ClN3O3- |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-[3-[(Z)-N-[(7-chloroquinolin-4-yl)amino]-C-methylcarbonimidoyl]phenoxy]acetate |
| SMILES | C/C(=N/Nc1ccnc2cc(Cl)ccc12)c1cccc(OCC(=O)[O-])c1 |
| InChI | InChI=1S/C19H16ClN3O3/c1-12(13-3-2-4-15(9-13)26-11-19(24)25)22-23-17-7-8-21-18-10-14(20)5-6-16(17)18/h2-10H,11H2,1H3,(H,21,23)(H,24,25)/p-1/b22-12- |
| InChIKey | GMNXKGKOUXAQDG-UUYOSTAYSA-M |
| XLogP | 2.85 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|